2-Bromo-4-fluorobenzoic acid
- Product Name2-Bromo-4-fluorobenzoic acid
- CAS1006-41-3
- MFC7H4BrFO2
- MW219.01
- EINECS600-118-8
- MOL File1006-41-3.mol
Chemical Properties
| Melting point | 172-176 °C (lit.) |
| Boiling point | 294.3±25.0 °C(Predicted) |
| Density | 1.7218 (rough estimate) |
| refractive index | 1.4240 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.79±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Soluble in water and methanol. |
| BRN | 2614292 |
| InChI | InChI=1S/C7H4BrFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | RRKPMLZRLKTDQV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Br |
| CAS DataBase Reference | 1006-41-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
