Fmoc-L-glutamic acid 5-tert-butyl ester
- Product NameFmoc-L-glutamic acid 5-tert-butyl ester
- CAS71989-18-9
- MFC24H27NO6
- MW425.47
- EINECS276-253-8
- MOL File71989-18-9.mol
Chemical Properties
| Melting point | 83-90 °C |
| alpha | -4.5 º (c=1, 80% acetic acid) |
| Boiling point | 633.5±55.0 °C(Predicted) |
| Density | 1.232±0.06 g/cm3(Predicted) |
| refractive index | -4 ° (C=1, 80% AcOH) |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.70±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 5.0±2.0°, c = 1% in acetic acid: water (4:1) |
| BRN | 3636375 |
| Major Application | peptide synthesis |
| InChIKey | OTKXCALUHMPIGM-FQEVSTJZSA-N |
| SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 71989-18-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |
