9-Fluorenylmethyl pentafluorophenyl carbonate
- Product Name9-Fluorenylmethyl pentafluorophenyl carbonate
- CAS88744-04-1
- MFC21H11F5O3
- MW406.3
- EINECS
- MOL File88744-04-1.mol
Chemical Properties
| Melting point | 85-87 °C(lit.) |
| Boiling point | 472.6±45.0 °C(Predicted) |
| Density | 1.457 |
| Flash point | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 300nm(EtOH)(lit.) |
| BRN | 4594899 |
| InChI | InChI=1S/C21H11F5O3/c22-15-16(23)18(25)20(19(26)17(15)24)29-21(27)28-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| InChIKey | CBBKZVZOEBSFQX-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 88744-04-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |