| Melting point |
190 °C (dec.)(lit.) |
| alpha |
-13 º (c=1,DMF) |
| Boiling point |
487.59°C (rough estimate) |
| Density |
1.3354 (rough estimate) |
| refractive index |
-13 ° (C=1, DMF) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in water or 1% acetic acid |
| form |
powder to crystal |
| pka |
3.68±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
-11..88°(C=0.01g/mI, DMF, 20°C, 589nm) |
| BRN |
4335103 |
| Major Application |
peptide synthesis |
| InChI |
1S/C19H18N2O5/c20-17(22)9-16(18(23)24)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,22)(H,21,25)(H,23,24) |
| InChIKey |
YUGBZNJSGOBFOV-UHFFFAOYSA-N |
| SMILES |
N(C(CC(=O)N)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| CAS DataBase Reference |
71989-16-7(CAS DataBase Reference) |
