Nalpha-FMOC-L-Tryptophan
- Product NameNalpha-FMOC-L-Tryptophan
- CAS35737-15-6
- MFC26H22N2O4
- MW426.46
- EINECS252-706-5
- MOL File35737-15-6.mol
Chemical Properties
| Melting point | 182-185 °C(lit.) |
| Boiling point | 541.92°C (rough estimate) |
| alpha | -29 º (c=1,DMF) |
| Density | 1.2501 (rough estimate) |
| refractive index | -28.5 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Pyridine |
| form | powder to crystal |
| pka | 3.89±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 29±1°, c = 1% in DMF |
| BRN | 4216624 |
| Major Application | peptide synthesis |
| InChIKey | MGHMWKZOLAAOTD-DEOSSOPVSA-N |
| SMILES | C(O)(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 35737-15-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 2933 99 80 |
| Storage Class | 11 - Combustible Solids |
