Methyl pentafluorophenyl carbonate
- Product NameMethyl pentafluorophenyl carbonate
- CAS36919-03-6
- MFC8H3F5O3
- MW242.1
- EINECS678-764-5
- MOL File36919-03-6.mol
Chemical Properties
| Melting point | 24°C |
| Boiling point | 84°C 3mm |
| Density | 1.567±0.06 g/cm3(Predicted) |
| Flash point | 84°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2289710 |
| InChI | InChI=1S/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| InChIKey | HGYOVHMDBHQLOE-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)OC |
Safety Information
| Risk Statements | 22-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| HS Code | 2920.90.5100 |
| HazardClass | 6.1 |
| PackingGroup | III |
