Pentafluorophenyl methacrylate
- Product NamePentafluorophenyl methacrylate
- CAS13642-97-2
- MFC10H5F5O2
- MW252.14
- EINECS
- MOL File13642-97-2.mol
Chemical Properties
| Boiling point | 56 °C(Press: 3 Torr) |
| Density | 1.394 g/mL at 25 °C |
| refractive index | n20/D1.438 |
| Flash point | 77℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C10H5F5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1H2,2H3 |
| InChIKey | NIJWSVFNELSKMF-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)C(C)=C |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29161400 |
| Storage Class | 10 - Combustible liquids |