Tetramethylammonium sulfate
- Product NameTetramethylammonium sulfate
- CAS14190-16-0
- MFC8H24N2O4S
- MW244.35
- EINECS238-043-4
- MOL File14190-16-0.mol
Chemical Properties
| Melting point | 285°C(dec.)(lit.) |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| λmax | λ: 210 nm Amax: ≤0.1 λ: 220 nm Amax: ≤0.04 λ: 230 nm Amax: ≤0.03 λ: 260 nm Amax: ≤0.02 λ: 500 nm Amax: ≤0.02 |
| BRN | 3918039 |
| InChI | 1S/2C4H12N.H2O4S/c3*1-5(2,3)4/h2*1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | KJFVITRRNTVAPC-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.[O-]S([O-])(=O)=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 2923.90.0100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
