6-Undecanone
- Product Name6-Undecanone
- CAS927-49-1
- MFC11H22O
- MW170.29
- EINECS213-150-9
- MOL File927-49-1.mol
Chemical Properties
| Melting point | 14.6 °C(lit.) |
| Boiling point | 228 °C(lit.) |
| Density | 0.831 g/mL at 25 °C(lit.) |
| FEMA | 4022 | 6-UNDECANONE |
| refractive index | n |
| Flash point | 191 °F |
| storage temp. | Store at room temperature |
| form | liquid |
| color | Colorless to Light yellow to Light orange |
| Thermal Conductivity | 0.132 W/(m·K) at 25 ℃ |
| JECFA Number | 1155 |
| Henry's Law Constant | 1.5×10-2 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | InChI=1S/C11H22O/c1-3-5-7-9-11(12)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | ZPQAKYPOZRXKFA-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)CCCCC |
| LogP | 4.09 |
| CAS DataBase Reference | 927-49-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | YQ2828000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29141990 |
| Storage Class | 10 - Combustible liquids |
