4-Methoxyphenylboronic acid
- Product Name4-Methoxyphenylboronic acid
- CAS5720-07-0
- MFC7H9BO3
- MW151.96
- EINECS611-482-2
- MOL File5720-07-0.mol
Chemical Properties
| Melting point | 204-206 °C(lit.) |
| Boiling point | 306.8±44.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| form | Crystalline Powder |
| pka | 8.96±0.10(Predicted) |
| color | White to light beige |
| BRN | 2936912 |
| InChI | InChI=1S/C7H9BO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | VOAAEKKFGLPLLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(OC)C=C1)(O)O |
| CAS DataBase Reference | 5720-07-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | CY8975000 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
