5-Bromo-2-methoxyphenol
- Product Name5-Bromo-2-methoxyphenol
- CAS37942-01-1
- MFC7H7BrO2
- MW203.03
- EINECS609-492-7
- MOL File37942-01-1.mol
Chemical Properties
| Melting point | 64-70 |
| Boiling point | 150 °C / 20mmHg |
| Density | 1.585±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 9.01±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H7BrO2/c1-10-7-3-2-5(8)4-6(7)9/h2-4,9H,1H3 |
| InChIKey | OLSJHVZRUFFIPL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Br)=CC=C1OC |
| CAS DataBase Reference | 37942-01-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant/Store Cold |
| HazardClass | IRRITANT |
| HS Code | 29095000 |
