2-Bromo-6-methoxy-phenol
- Product Name2-Bromo-6-methoxy-phenol
- CAS28165-49-3
- MFC7H7BrO2
- MW203.03
- EINECS606-276-4
- MOL File28165-49-3.mol
Chemical Properties
| Melting point | 62-65°C |
| Boiling point | 146°C/4mmHg(lit.) |
| Density | 1.585±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.43±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H7BrO2/c1-10-6-4-2-3-5(8)7(6)9/h2-4,9H,1H3 |
| InChIKey | WEUFQISIJPSTBM-UHFFFAOYSA-N |
| SMILES | C1(O)=C(OC)C=CC=C1Br |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HazardClass | IRRITANT |
| HS Code | 29095000 |
