FLUCYTHRINATE
- Product NameFLUCYTHRINATE
- CAS70124-77-5
- MFC26H23F2NO4
- MW451.47
- EINECS274-322-7
- MOL File70124-77-5.mol
Chemical Properties
| Melting point | <25℃ |
| Boiling point | 108℃ (0.35mmHg) |
| Density | 1.189 g/cm3 (22℃) |
| vapor pressure | 1.2×10-6 Pa (25 °C) |
| refractive index | 1.541 (589.3 nm 25℃) |
| Flash point | -18 °C |
| storage temp. | 2-8°C |
| Water Solubility | 0.5 mg l-1 (22 °C) |
| Specific Gravity | 1.189 (22℃) |
| BRN | 2195795 |
| Henry's Law Constant | 1.1×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture |
| InChI | 1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3 |
| InChIKey | GBIHOLCMZGAKNG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c3ccc(OC(F)F)cc3 |
| CAS DataBase Reference | 70124-77-5(CAS DataBase Reference) |
| EPA Substance Registry System | Flucythrinate (70124-77-5) |
Safety Information
| Hazard Codes | T,N,Xn,F |
| Risk Statements | 20/21-25-50/53-67-65-38-11 |
| Safety Statements | 36/37-45-60-61-62 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1578620 |
| HS Code | 29269090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 70124-77-5(Hazardous Substances Data) |
| Toxicity | LC50 (96-hour) for rainbow trout 0.32 μg/L, bluegill sunsh 0.71 μg/L, channel catsh 0.51 μg/L, sheepshead minnow 1.6 μg/L (Hartley and Kidd, 1987), estuarine mysid 0.008 μg/L, pink shrimp 0.22 μg/L and sheepshead minnow 1.1 μg/L (Schimmel et al., 1983); acute oral LD50 for male and female rats is 81 and 67 mg/kg, respectively (Hartley and Kidd, 1987). |