2-Hydroxy-6-methylpyridine-3-carboxylic acid
- Product Name2-Hydroxy-6-methylpyridine-3-carboxylic acid
- CAS38116-61-9
- MFC7H7NO3
- MW153.14
- EINECS253-784-3
- MOL File38116-61-9.mol
Chemical Properties
| Melting point | 233-235 °C(lit.) |
| Boiling point | 276.03°C (rough estimate) |
| Density | 1.3585 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.54±0.20(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 129164 |
| InChI | InChI=1S/C7H7NO3/c1-4-2-3-5(7(10)11)6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
| InChIKey | XRIHTJYXIHOBDQ-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC=C1C(O)=O |
| CAS DataBase Reference | 38116-61-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 36/37/39-26-22 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
