| Melting point |
137-139 °C(lit.) |
| Boiling point |
342.97°C (rough estimate) |
| Density |
1.1783 (rough estimate) |
| refractive index |
1.5570 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
very soluble in Benzene,Ether,Acetone,Alcohol |
| form |
powder to crystal |
| pka |
3.33±0.36(Predicted) |
| color |
White to Almost white |
| Merck |
14,9539 |
| BRN |
2111078 |
| InChI |
InChI=1S/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18) |
| InChIKey |
ICQOWIXIHDDXDI-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(C)C=C1 |
| CAS DataBase Reference |
85-55-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzoic acid, 2-(4-methylbenzoyl)-(85-55-2) |
| EPA Substance Registry System |
Benzoic acid, 2-(4-methylbenzoyl)- (85-55-2) |
