Methyl 4-(bromomethyl)benzoate
- Product NameMethyl 4-(bromomethyl)benzoate
- CAS2417-72-3
- MFC9H9BrO2
- MW229.07
- EINECS607-335-7
- MOL File2417-72-3.mol
Chemical Properties
| Melting point | 57-58 °C(lit.) |
| Boiling point | 130-135 °C2 mm Hg(lit.) |
| Density | 1,47 g/cm3 |
| refractive index | 1.5320 (estimate) |
| Flash point | 130-135°C/2mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to yellow |
| Water Solubility | Lowly soluble in water, highly soluble in ethanol and ether, not soluble in halogenated organic solvents |
| Sensitive | Lachrymatory |
| BRN | 1867272 |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | NLWBJPPMPLPZIE-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 2417-72-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 22-34-43 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Resp. Sens. 1 Skin Corr. 1B |
