| Melting point |
287-289 °C (lit.) |
| Boiling point |
355.4°C (rough estimate) |
| Density |
1.469 |
| refractive index |
1.4872 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Soluble in hot Acetic acid(almost transparency). |
| form |
powder to crystal |
| pka |
pK1: 3.42 (20°C) |
| color |
White to Amber |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C15H8O4/c16-13-9-3-1-2-4-10(9)14(17)12-7-8(15(18)19)5-6-11(12)13/h1-7H,(H,18,19) |
| InChIKey |
ASDLSKCKYGVMAI-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1C(O)=O |
| CAS DataBase Reference |
117-78-2(CAS DataBase Reference) |
