1,4-Diphenoxybenzene
- Product Name1,4-Diphenoxybenzene
- CAS3061-36-7
- MFC18H14O2
- MW262.3
- EINECS000-000-0
- MOL File3061-36-7.mol
Chemical Properties
| Melting point | 73-77 °C |
| Boiling point | 172°C 0,01mm |
| Density | 1,083 g/cm3 |
| refractive index | 1.5200 (estimate) |
| Flash point | 202°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2215945 |
| InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H |
| InChIKey | UVGPELGZPWDPFP-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=CC=C2)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 3061-36-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,4-diphenoxy-(3061-36-7) |
| EPA Substance Registry System | Benzene, 1,4-diphenoxy- (3061-36-7) |
Safety Information
| Safety Statements | 24/25 |
| TSCA | Yes |
| HS Code | 29029090 |
