Boc-L-Pyroglutamic acid methyl ester
- Product NameBoc-L-Pyroglutamic acid methyl ester
- CAS108963-96-8
- MFC11H17NO5
- MW243.26
- EINECS600-890-6
- MOL File108963-96-8.mol
Chemical Properties
| Melting point | 68-72 °C 69-74 °C |
| Boiling point | 361.6±35.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in dichloromethane. |
| pka | -4.28±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]22/D 32.0°, c = 0.5 in chloroform &_& [α]22/D -32°, c = 0.5% in chloroform |
| InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(15)12-7(9(14)16-4)5-6-8(12)13/h7H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | FNTAOUUEQHKLIU-ZETCQYMHSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C(=O)CC[C@H]1C(OC)=O |
| CAS DataBase Reference | 108963-96-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 36-43-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29337900 |
