| Melting point |
74-76°C |
| Boiling point |
202-205°C 3mm |
| Density |
1.07±0.1 g/cm3(Predicted) |
| Flash point |
202-205°C/3mm |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
insoluble |
| InChI |
InChI=1S/C15H13N/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h3-10H,2H2,1H3 |
| InChIKey |
DLLIPJSMDJCZRF-UHFFFAOYSA-N |
| SMILES |
C1(C2=CC=C(CC)C=C2)=CC=C(C#N)C=C1 |
| CAS DataBase Reference |
58743-75-2(CAS DataBase Reference) |
| EPA Substance Registry System |
[1,1'-Biphenyl]-4-carbonitrile, 4'-ethyl- (58743-75-2) |
