2-Amino-5-chloro-3-nitropyridine
- Product Name2-Amino-5-chloro-3-nitropyridine
- CAS5409-39-2
- MFC5H4ClN3O2
- MW173.56
- EINECS
- MOL File5409-39-2.mol
Chemical Properties
| Melting point | 193-197 °C (lit.) |
| Boiling point | 305.8±37.0 °C(Predicted) |
| Density | 1.596 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 0.17±0.49(Predicted) |
| color | Light yellow to Brown to Dark green |
| BRN | 383850 |
| InChI | 1S/C5H4ClN3O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H,(H2,7,8) |
| InChIKey | GILTXHIJUUIMPI-UHFFFAOYSA-N |
| SMILES | Nc1ncc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 5409-39-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |