| Melting point |
155-163 °C (lit.) |
| Boiling point |
466.93°C (rough estimate) |
| Density |
0.9523 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
Crystalline Powder |
| color |
White to ivory |
| Water Solubility |
soluble |
| Sensitive |
Hygroscopic |
| BRN |
3776210 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C19H34N.ClH/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;/h10-14H,4-9,15-18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey |
VJGNLOIQCWLBJR-UHFFFAOYSA-M |
| SMILES |
[N+](CCCC)(CCCC)(CCCC)CC1=CC=CC=C1.[Cl-] |
| CAS DataBase Reference |
23616-79-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenemethanaminium, N,N,N-tributyl-, chloride (23616-79-7) |
