Methyl tributyl ammonium chloride
- Product NameMethyl tributyl ammonium chloride
- CAS56375-79-2
- MFC13H30ClN
- MW235.84
- EINECS260-135-8
- MOL File56375-79-2.mol
Chemical Properties
| Melting point | 95-99 °C |
| Boiling point | 84-85°C 101mm |
| Density | 0,964 g/cm3 |
| vapor pressure | 7.9 mmHg ( 25 °C) |
| refractive index | n20/D 1.4682 |
| Flash point | 84-85°C/101mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 6300212 |
| InChI | 1S/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IPILPUZVTYHGIL-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[N+](C)(CCCC)CCCC |
| LogP | -2--0.842 at 20-25℃ |
| CAS DataBase Reference | 56375-79-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N-dibutyl-N-methyl-, chloride (56375-79-2) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-36-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36/37 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29211990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |
