Benzyltributylammonium chloride
- Product NameBenzyltributylammonium chloride
- CAS23616-79-7
- CBNumberCB7239524
- MFC19H34ClN
- MW311.93
- EINECS245-787-3
- MDL NumberMFCD00011849
- MOL File23616-79-7.mol
Chemical Properties
| Melting point | 155-163 °C (lit.) |
| Boiling point | 466.93°C (rough estimate) |
| Density | 0.9523 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to ivory |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3776210 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C19H34N.ClH/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;/h10-14H,4-9,15-18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VJGNLOIQCWLBJR-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CC1=CC=CC=C1.[Cl-] |
| CAS DataBase Reference | 23616-79-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenemethanaminium, N,N,N-tributyl-, chloride (23616-79-7) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xn,Xi,C | |||||||||
| Risk Statements | 22-36/37/38-34 | |||||||||
| Safety Statements | 26-36-37/39-45-36/37/39 | |||||||||
| RIDADR | UN 3263 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3 | |||||||||
| Hazard Note | Irritant/Hygroscopic | |||||||||
| TSCA | Yes | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29239000 | |||||||||
| NFPA 704: |
|
