1,2,4-Triacetoxybenzene
- Product Name1,2,4-Triacetoxybenzene
- CAS613-03-6
- MFC12H12O6
- MW252.22
- EINECS210-327-2
- MOL File613-03-6.mol
Chemical Properties
| Melting point | 98-100 °C(lit.) |
| Boiling point | 300°C (estimate) |
| Density | 1.3694 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2138876 |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6H,1-3H3 |
| InChIKey | AESFGSJWSUZRGW-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C)=CC=C(OC(=O)C)C=C1OC(=O)C |
| CAS DataBase Reference | 613-03-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2,4-Tri-acetoxybenzene(613-03-6) |
| EPA Substance Registry System | 1,2,4-Benzenetriol, triacetate (613-03-6) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DC4800000 |
| TSCA | TSCA listed |
| HS Code | 2915.39.3500 |
| Storage Class | 11 - Combustible Solids |
