1,2,4-Triacetoxybenzene
- Product Name1,2,4-Triacetoxybenzene
- CAS613-03-6
- CBNumberCB7185436
- MFC12H12O6
- MW252.22
- EINECS210-327-2
- MDL NumberMFCD00008700
- MOL File613-03-6.mol
Chemical Properties
| Melting point | 98-100 °C(lit.) |
| Boiling point | 300°C (estimate) |
| Density | 1.3694 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2138876 |
| InChI | InChI=1S/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6H,1-3H3 |
| InChIKey | AESFGSJWSUZRGW-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C)=CC=C(OC(=O)C)C=C1OC(=O)C |
| CAS DataBase Reference | 613-03-6(CAS DataBase Reference) |
| EWG's Food Scores | 1-4 |
| FDA UNII | 903T7H7CP1 |
| NIST Chemistry Reference | 1,2,4-Tri-acetoxybenzene(613-03-6) |
| EPA Substance Registry System | 1,2,4-Benzenetriol, triacetate (613-03-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H332-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DC4800000 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 2915.39.3500 | |||||||||
| NFPA 704: |
|
