| Melting point |
262-269 °C |
| Boiling point |
290-293 °C (lit.) |
| Density |
1.073 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.643(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
Miscible with ethanol, ether and carbon disulfide. |
| form |
Liquid |
| pka |
9.06±0.30(Predicted) |
| color |
Clear light yellow to yellow |
| Sensitive |
Air Sensitive |
| BRN |
2206459 |
| InChI |
InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 |
| InChIKey |
NVSYANRBXPURRQ-UHFFFAOYSA-N |
| SMILES |
C1(CN)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference |
118-31-0(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Naphthalenemethanamine (118-31-0) |
