1-Naphthalenemethylamine
- Product Name1-Naphthalenemethylamine
- CAS118-31-0
- MFC11H11N
- MW157.21
- EINECS204-244-0
- MOL File118-31-0.mol
Chemical Properties
| Melting point | 262-269 °C |
| Boiling point | 290-293 °C (lit.) |
| Density | 1.073 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Miscible with ethanol, ether and carbon disulfide. |
| form | Liquid |
| pka | 9.06±0.30(Predicted) |
| color | Clear light yellow to yellow |
| Sensitive | Air Sensitive |
| BRN | 2206459 |
| InChI | InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 |
| InChIKey | NVSYANRBXPURRQ-UHFFFAOYSA-N |
| SMILES | C1(CN)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 118-31-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenemethanamine (118-31-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
