(+/-)1-(1-Naphthyl)ethylamine
- Product Name(+/-)1-(1-Naphthyl)ethylamine
- CAS42882-31-5
- MFC12H13N
- MW171.24
- EINECS610-076-2
- MOL File42882-31-5.mol
Chemical Properties
| Boiling point | 156 °C15 mm Hg(lit.) |
| Density | 1.063 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in alcohol, ether; insoluble in H2O |
| form | clear liquid |
| pka | 9.26±0.40(Predicted) |
| color | Colorless to Yellow to Green |
| optical activity | Consistent with structure |
| Sensitive | Air Sensitive |
| BRN | 3197375 |
| InChI | InChI=1S/C12H13N/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,13H2,1H3 |
| InChIKey | RTCUCQWIICFPOD-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=CC=CC=2C(N)C |
| CAS DataBase Reference | 42882-31-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenemethanamine, .alpha.-methyl- (42882-31-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-34-25 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |