(R)-(-)-1-(1-Naphthyl)ethyl isocyanate
- Product Name(R)-(-)-1-(1-Naphthyl)ethyl isocyanate
- CAS42340-98-7
- MFC13H11NO
- MW197.23
- EINECS255-759-2
- MOL File42340-98-7.mol
Chemical Properties
| Boiling point | 106-108 °C0.16 mm Hg(lit.) |
| Density | 1.118 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 200 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| optical activity | [α]20/D 47±2°, c = 3.5% in toluene |
| Sensitive | Moisture Sensitive |
| BRN | 4181805 |
| InChI | 1S/C13H11NO/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m1/s1 |
| InChIKey | GONOHGQPZFXJOJ-SNVBAGLBSA-N |
| SMILES | C[C@@H](N=C=O)c1cccc2ccccc12 |
| CAS DataBase Reference | 42340-98-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 23-26-36/37 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2929.10.8090 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |