Melting point |
189.5-190 °C |
Boiling point |
104 °C |
Density |
1,05 g/cm3 |
refractive index |
1.6160-1.6190 |
storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
solubility |
Chloroform (Slightly), Ethyl Acetate (Slightly) |
form |
clear liquid |
pka |
9.38±0.10(Predicted) |
color |
Colorless to Orange to Green |
PH |
10.71 at 24℃ and 10g/L |
InChI |
InChI=1S/C12H13N/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11/h2-8,13H,9H2,1H3 |
InChIKey |
MQRIUFVBEVFILS-UHFFFAOYSA-N |
SMILES |
C1(CNC)=C2C(C=CC=C2)=CC=C1 |
CAS DataBase Reference |
14489-75-9(CAS DataBase Reference) |