| Melting point |
173-178 °C(lit.) |
| Boiling point |
298.46°C (rough estimate) |
| Density |
1.1616 (rough estimate) |
| vapor pressure |
0.61-7.2Pa at 100-130℃ |
| refractive index |
1.4900 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
methanol: soluble25mg/mL, clear to slightly hazy, yellow to brown |
| pka |
13.27±0.20(Predicted) |
| form |
Powder |
| color |
Light orange to Yellow to Green |
| InChI |
InChI=1S/C11H7NO/c13-11-8-5-1-3-7-4-2-6-9(12-11)10(7)8/h1-6H,(H,12,13) |
| InChIKey |
GPYLCFQEKPUWLD-UHFFFAOYSA-N |
| SMILES |
N1C2=C3C(C=CC=C3C1=O)=CC=C2 |
| LogP |
2.5 at 24℃ and pH6.6 |
| CAS DataBase Reference |
130-00-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Benz[cd]indol-2(1H)-one (130-00-7) |