| Melting point |
178-181 °C(lit.) |
| Boiling point |
273.17°C (rough estimate) |
| Density |
1.2023 (rough estimate) |
| refractive index |
1.5810 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
almost transparency in hot Methanol |
| form |
powder to crystal |
| pka |
3.09±0.10(Predicted) |
| color |
White to Light yellow to Light orange |
| BRN |
2803090 |
| InChI |
InChI=1S/C8H9NO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey |
BYHMLZGICSEKIY-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC(N)=C1C |
| CAS DataBase Reference |
52130-17-3(CAS DataBase Reference) |
