3-Fluorobenzonitrile
- Product Name3-Fluorobenzonitrile
- CAS403-54-3
- MFC7H4FN
- MW121.11
- EINECS206-963-5
- MOL File403-54-3.mol
Chemical Properties
| Melting point | 15 °C |
| Boiling point | 183 °C |
| Density | 1.14 |
| refractive index | 1.50 |
| Flash point | 68 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| Specific Gravity | 1.133 |
| BRN | 1858941 |
| InChI | InChI=1S/C7H4FN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | JZTPKAROPNTQQV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(F)=C1 |
| CAS DataBase Reference | 403-54-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3-fluoro-(403-54-3) |
| EPA Substance Registry System | Benzonitrile, 3-fluoro- (403-54-3) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-39-36/37/39-36 |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
