Tetrafluoroterephthalonitrile
- Product NameTetrafluoroterephthalonitrile
- CAS1835-49-0
- MFC8F4N2
- MW200.09
- EINECS217-397-3
- MOL File1835-49-0.mol
Chemical Properties
| Melting point | 197-199 °C (lit.) |
| Boiling point | 243.3±40.0 °C(Predicted) |
| Density | 1.6184 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in hot methanol. |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 |
| InChIKey | PCRSJGWFEMHHEW-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(C#N)C(F)=C1F |
| CAS DataBase Reference | 1835-49-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenedicarbonitrile, 2,3,5,6-tetrafluoro-(1835-49-0) |
| EPA Substance Registry System | Tetrafluoroterephthalonitrile (1835-49-0) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-20/21-23/24/25-36/37/39-20/21/22 |
| Safety Statements | 26-45-37/39-22-36/37/39-27 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CZ1955000 |
| Hazard Note | Toxic |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,oral,56mg/kg (56mg/kg),Journal of Medicinal Chemistry. Vol. 21, Pg. 906, 1978. |
