Tetrafluorophthalic acid
- Product NameTetrafluorophthalic acid
- CAS652-03-9
- MFC8H2F4O4
- MW238.09
- EINECS211-483-4
- MOL File652-03-9.mol
Chemical Properties
| Melting point | 152-154 °C(lit.) |
| Boiling point | 345.7±42.0 °C(Predicted) |
| Density | 1.6239 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 1.28±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 2057012 |
| InChI | InChI=1S/C8H2F4O4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h(H,13,14)(H,15,16) |
| InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C(F)C(F)=C(F)C(F)=C1C(O)=O |
| CAS DataBase Reference | 652-03-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalic acid(652-03-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
