3,4,5,6-Tetrafluorophthalonitrile
- Product Name3,4,5,6-Tetrafluorophthalonitrile
- CAS1835-65-0
- MFC8F4N2
- MW200.09
- EINECS217-400-8
- MOL File1835-65-0.mol
Chemical Properties
| Melting point | 81-86 °C(lit.) |
| Boiling point | 274.2±40.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol,Acetone,Ethanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)4(2-14)6(10)8(12)7(5)11 |
| InChIKey | OFLRJMBSWDXSPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(F)C(F)=C1C#N |
| CAS DataBase Reference | 1835-65-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalonitrile(1835-65-0) |
| EPA Substance Registry System | Tetrafluorophthalonitrile (1835-65-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Lachrymator |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |