| Melting point |
295-300 °C (dec.) (lit.) |
| Boiling point |
98.5-99.5 ;°C/740 ;mmHg(lit .) |
| Density |
1.006 g/mL at 20 °C |
| bulk density |
900kg/m3 |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
H2O: 100 mg/mL, clear, colorless |
| form |
Solid |
| color |
White |
| PH |
4.00-4.02 (25.0℃±0.2℃, 0.05M) |
| Odor |
Odorless |
| PH Range |
3.8 - 4.0 (5% aq. sol.) |
| Water Solubility |
80 G/L (20 ºC) |
| Merck |
14,7612 |
| BRN |
3637128 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
BUFFERING |
| InChI |
1S/C8H6O4.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey |
IWZKICVEHNUQTL-UHFFFAOYSA-M |
| SMILES |
[K+].OC(=O)c1ccccc1C([O-])=O |
| LogP |
-2.73 |
| CAS DataBase Reference |
877-24-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Monopotassium phthalate (877-24-7) |
| Absorption |
cut-off at 309nm in H2O at 0.1M |