Bis(2-methoxyethyl) phthalate
- Product NameBis(2-methoxyethyl) phthalate
- CAS117-82-8
- MFC14H18O6
- MW282.29
- EINECS204-212-6
- MOL File117-82-8.mol
Chemical Properties
| Melting point | -42.4°C |
| Boiling point | 230 °C10 mm Hg(lit.) |
| Density | 1.173 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 230°C/10mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.17 |
| Water Solubility | Soluble in water 8500 mg/L at 25°C. |
| BRN | 2056929 |
| Henry's Law Constant | 2.3×101 mol/(m3Pa) at 25℃, Fishbein and Albro (1972) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C14H18O6/c1-17-7-9-19-13(15)11-5-3-4-6-12(11)14(16)20-10-8-18-2/h3-6H,7-10H2,1-2H3 |
| InChIKey | HSUIVCLOAAJSRE-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)c1ccccc1C(=O)OCCOC |
| CAS DataBase Reference | 117-82-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61-62 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| RTECS | TI1400000 |
| TSCA | TSCA listed |
| HS Code | 29173490 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
| Hazardous Substances Data | 117-82-8(Hazardous Substances Data) |