3,4,5,6-Tetrafluorophthalonitrile
- Product Name3,4,5,6-Tetrafluorophthalonitrile
- CAS1835-65-0
- CBNumberCB6202574
- MFC8F4N2
- MW200.09
- EINECS217-400-8
- MDL NumberMFCD00001774
- MOL File1835-65-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 81-86 °C(lit.) |
| Boiling point | 274.2±40.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol,Acetone,Ethanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)4(2-14)6(10)8(12)7(5)11 |
| InChIKey | OFLRJMBSWDXSPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(F)C(F)=C1C#N |
| CAS DataBase Reference | 1835-65-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalonitrile(1835-65-0) |
| EPA Substance Registry System | Tetrafluorophthalonitrile (1835-65-0) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 3439 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant/Lachrymator | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29269090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

