
1835-65-0
| Name | 3,4,5,6-Tetrafluorophthalonitrile |
| CAS | 1835-65-0 |
| EINECS(EC#) | 217-400-8 |
| Molecular Formula | C8F4N2 |
| MDL Number | MFCD00001774 |
| Molecular Weight | 200.09 |
| MOL File | 1835-65-0.mol |
Chemical Properties
| Melting point | 81-86 °C(lit.) |
| Boiling point | 274.2±40.0 °C(Predicted) |
| density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol,Acetone,Ethanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)4(2-14)6(10)8(12)7(5)11 |
| InChIKey | OFLRJMBSWDXSPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(F)C(F)=C1C#N |
| CAS DataBase Reference | 1835-65-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalonitrile(1835-65-0) |
| EPA Substance Registry System | 1835-65-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Lachrymator |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
