3-Fluorophthalic acid
- Product Name3-Fluorophthalic acid
- CAS1583-67-1
- CBNumberCB0305097
- MFC8H5FO4
- MW184.12
- EINECS216-433-5
- MDL NumberMFCD00039524
- MOL File1583-67-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 175-177 °C (lit.) |
| Boiling point | 367.9±27.0 °C(Predicted) |
| Density | 1.4111 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Soluble[in water] |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 2.32±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2616684 |
| InChI | InChI=1S/C8H5FO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | BBCQSMSCEJBIRD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=CC(F)=C1C(O)=O |
| CAS DataBase Reference | 1583-67-1(CAS DataBase Reference) |
| FDA UNII | 5N469ZY8M2 |
| NIST Chemistry Reference | 3-Fluorophthalic acid(1583-67-1) |
| UNSPSC Code | 12352106 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29173990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
