1,2-Dibromotetrafluorobenzene
- Product Name1,2-Dibromotetrafluorobenzene
- CAS827-08-7
- MFC6Br2F4
- MW307.87
- EINECS212-564-7
- MOL File827-08-7.mol
Chemical Properties
| Melting point | 16 °C |
| Boiling point | 96 °C/25 mmHg |
| Density | 2.26 |
| refractive index | 1.52 |
| Flash point | 99 °C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 2.238 |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C6Br2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | IPLUWQPTPKNBRD-UHFFFAOYSA-N |
| SMILES | C1(Br)=C(F)C(F)=C(F)C(F)=C1Br |
| CAS DataBase Reference | 827-08-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-dibromo-3,4,5,6-tetrafluoro-(827-08-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2903999090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
