1,2-Dibromo-4,5-difluorobenzene
- Product Name1,2-Dibromo-4,5-difluorobenzene
- CAS64695-78-9
- MFC6H2Br2F2
- MW271.88
- EINECS265-021-1
- MOL File64695-78-9.mol
Chemical Properties
| Melting point | 33-35 °C (lit.) |
| Boiling point | 216.2±35.0 °C(Predicted) |
| Density | 2.1030 (rough estimate) |
| refractive index | 1.5151 (estimate) |
| Flash point | 112 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Water Solubility | insoluble |
| BRN | 1941132 |
| InChI | InChI=1S/C6H2Br2F2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | JTEZQWOKRHOKDG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1Br |
| CAS DataBase Reference | 64695-78-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Dibromo-4,5-difluorobenzene(64695-78-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-24/25 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |