5-Fluoro-2-methylbenzonitrile
- Product Name5-Fluoro-2-methylbenzonitrile
- CAS77532-79-7
- MFC8H6FN
- MW135.14
- EINECS
- MOL File77532-79-7.mol
Chemical Properties
| Melting point | 43-45 °C (lit.) |
| Boiling point | 230°C (rough estimate) |
| Density | 1.1203 (estimate) |
| Flash point | 175 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 7700578 |
| InChI | InChI=1S/C8H6FN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,1H3 |
| InChIKey | IBRODYNXELBTJC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(F)=CC=C1C |
| CAS DataBase Reference | 77532-79-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Fluoro-2-methylbenzonitrile(77532-79-7) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |