| Melting point |
42-44 °C (lit.) |
| Boiling point |
151 °C |
| Density |
1.1850 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
4.10±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
Slightly soluble in chloroform and methanol. Insoluble in water. |
| BRN |
775898 |
| InChI |
InChI=1S/C8H7FO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey |
YEAUYVGUXSZCFI-UHFFFAOYSA-N |
| SMILES |
C1(CC(O)=O)=CC=CC(F)=C1 |
| CAS DataBase Reference |
331-25-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
M-fluorophenylacetic acid(331-25-9) |
| EPA Substance Registry System |
Benzeneacetic acid, 3-fluoro- (331-25-9) |
