3,4-Difluorobenzonitrile
- Product Name3,4-Difluorobenzonitrile
- CAS64248-62-0
- MFC7H3F2N
- MW139.1
- EINECS264-751-8
- MOL File64248-62-0.mol
Chemical Properties
| Melting point | 52-54 °C (lit.) |
| Boiling point | 180 °C |
| Density | 1.2490 (estimate) |
| Flash point | 157 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Light yellow |
| BRN | 2082224 |
| InChI | InChI=1S/C7H3F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| InChIKey | BTBFCBQZFMQBNT-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 64248-62-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
