Tetraethylammonium tetrafluoroborate
- Product NameTetraethylammonium tetrafluoroborate
- CAS429-06-1
- MFC8H20BF4N
- MW217.06
- EINECS207-055-1
- MOL File429-06-1.mol
Chemical Properties
| Melting point | ≥300 °C(lit.) |
| Density | 1.23 at 20℃ |
| bulk density | 400kg/m3 |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Store below +30°C. |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White |
| Water Solubility | Soluble in water, alcohol and acetonitrile. |
| Sensitive | Hygroscopic |
| BRN | 3917638 |
| InChI | 1S/C8H20N.BF4/c1-5-9(6-2,7-3)8-4;2-1(3,4)5/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | VDMMJVHZGWXBJN-UHFFFAOYSA-M |
| SMILES | F[B-](F)(F)F.CC[N+](CC)(CC)CC |
| LogP | -3.5 at 20.2℃ and pH7 |
| Surface tension | 72.07mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 429-06-1(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, tetrafluoroborate(1-) (429-06-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Hygroscopic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |