Tetraethylammonium nitrate
- Product NameTetraethylammonium nitrate
- CAS1941-26-0
- MFC8H20N2O3
- MW192.26
- EINECS217-725-5
- MOL File1941-26-0.mol
Chemical Properties
| Melting point | ~280 °C (dec.) |
| Boiling point | >100 °C |
| Density | 1.029 g/mL at 25 °C |
| refractive index | 1.4450 (estimate) |
| Flash point | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Specific Gravity | 1.029 |
| BRN | 3918466 |
| Stability | Stable. Incompatible with reducing agents, combustible materials, strong oxidants. Strong oxidizer - contact with combustible material may lead to fire. |
| InChI | 1S/C8H20N.NO3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | JTJKNAJRGLQKDZ-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.CC[N+](CC)(CC)CC |
| EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, nitrate (1941-26-0) |
Safety Information
| Hazard Codes | Xi,O |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 26-36-17 |
| RIDADR | UN 3139 5.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
