| Melting point |
195 °C |
| Boiling point |
655.3±55.0 °C(Predicted) |
| Density |
1.2136 (rough estimate) |
| refractive index |
1.6510 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
soluble in Acetone |
| form |
powder to crystal |
| pka |
4.54±0.10(Predicted) |
| color |
White to Light yellow |
| InChI |
InChI=1S/C24H20N2O4S/c25-17-1-5-19(6-2-17)29-21-9-13-23(14-10-21)31(27,28)24-15-11-22(12-16-24)30-20-7-3-18(26)4-8-20/h1-16H,25-26H2 |
| InChIKey |
UTDAGHZGKXPRQI-UHFFFAOYSA-N |
| SMILES |
S(C1=CC=C(OC2=CC=C(N)C=C2)C=C1)(C1=CC=C(OC2=CC=C(N)C=C2)C=C1)(=O)=O |
| CAS DataBase Reference |
13080-89-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenamine, 4,4'-[sulfonylbis(4,1-phenyleneoxy)]bis- (13080-89-2) |