(R)-3-(Boc-Amino)piperidine
- Product Name(R)-3-(Boc-Amino)piperidine
- CAS309956-78-3
- MFC10H20N2O2
- MW200.28
- EINECS685-989-2
- MOL File309956-78-3.mol
Chemical Properties
| Melting point | 121.0 to 125.0 °C |
| Boiling point | 304.8±31.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol and ethanol. |
| pka | 12.37±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D +3.2°, c = 0.5 in DMF |
| BRN | 10662518 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8/h8,11H,4-7H2,1-3H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | WUOQXNWMYLFAHT-MRVPVSSYSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCCNC1 |
| CAS DataBase Reference | 309956-78-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 37/38-41-50 |
| Safety Statements | 26-39-61-29-36 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |